About 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate
4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate (PubChem CID 139075096) has the molecular formula C7H14N4O3
and a molecular weight of 202.21 g/mol. Its IUPAC name is 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate.
Molecular Properties
| Compound Name | 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate |
| PubChem CID | 139075096 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate |
| SMILES | Cc1cc(C)[nH]c(=O)n1.NC(N)=O.O |
| InChI | InChI=1S/C6H8N2O.CH4N2O.H2O/c1-4-3-5(2)8-6(9)7-4;2-1(3)4;/h3H,1-2H3,(H,7,8,9);(H4,2,3,4);1H2 |
| InChIKey | IADWYVSFOHPSKU-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate?
The IUPAC name of 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate (CID 139075096) is 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate.
What is the SMILES notation for 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate?
The canonical SMILES for 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate is Cc1cc(C)[nH]c(=O)n1.NC(N)=O.O.
What is the InChIKey of 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate?
The InChIKey is IADWYVSFOHPSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.CH4N2O.H2O/c1-4-3-5(2)8-6(9)7-4;2-1(3)4;/h3H,1-2H3,(H,7,8,9);(H4,2,3,4);1H2.
What are the key properties of 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate?
4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate has a molecular weight of 202.21 g/mol, XLogP of -1.41, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1H-pyrimidin-2-one;urea;hydrate is sourced from PubChem (CID 139075096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).