About 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol
2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol (PubChem CID 139075224) has the molecular formula C40H38N2O2
and a molecular weight of 578.76 g/mol. Its IUPAC name is 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol.
Molecular Properties
| Compound Name | 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol |
| PubChem CID | 139075224 |
| Molecular Formula | C40H38N2O2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol |
| SMILES | Cc1cccc(CC(O)(c2ccccc2)c2ccccc2)n1.Cc1cccc(CC(O)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/2C20H19NO/c2*1-16-9-8-14-19(21-16)15-20(22,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2*2-14,22H,15H2,1H3 |
| InChIKey | BXXBVDYVPCZWFV-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol?
The IUPAC name of 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol (CID 139075224) is 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol.
What is the SMILES notation for 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol?
The canonical SMILES for 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol is Cc1cccc(CC(O)(c2ccccc2)c2ccccc2)n1.Cc1cccc(CC(O)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol?
The InChIKey is BXXBVDYVPCZWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H19NO/c2*1-16-9-8-14-19(21-16)15-20(22,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2*2-14,22H,15H2,1H3.
What are the key properties of 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol?
2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol has a molecular weight of 578.76 g/mol, XLogP of 7.74, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2-pyridinyl)-1,1-diphenylethanol is sourced from PubChem (CID 139075224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).