C38H24N8 — CID 139075310
2-phenyl-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 139075310) has the molecular formula C38H24N8 and a molecular weight of 592.67 g/mol. Its IUPAC name is 2-phenyl-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-phenyl-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 139075310 |
| Molecular Formula | C38H24N8 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 2-phenyl-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1.c1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1 |
| InChI | InChI=1S/2C19H12N4/c2*1-2-6-12(7-3-1)19-22-17-13-8-4-10-20-15(13)16-14(18(17)23-19)9-5-11-21-16/h2*1-11H,(H,22,23) |
| InChIKey | REMLFDHMYADGDL-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|