C24H18N4O2 — CID 139075394
N-(1,10-phenanthrolin-5-yl)-4-pyridin-2-ylbenzamide;hydrate (PubChem CID 139075394) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(1,10-phenanthrolin-5-yl)-4-pyridin-2-ylbenzamide;hydrate.
| Compound Name | N-(1,10-phenanthrolin-5-yl)-4-pyridin-2-ylbenzamide;hydrate |
|---|---|
| PubChem CID | 139075394 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(1,10-phenanthrolin-5-yl)-4-pyridin-2-ylbenzamide;hydrate |
| SMILES | O.O=C(Nc1cc2cccnc2c2ncccc12)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C24H16N4O.H2O/c29-24(17-10-8-16(9-11-17)20-7-1-2-12-25-20)28-21-15-18-5-3-13-26-22(18)23-19(21)6-4-14-27-23;/h1-15H,(H,28,29);1H2 |
| InChIKey | BPNBCJFDPDJASQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|