About [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate
[(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate (PubChem CID 139075420) has the molecular formula C26H22N2O5
and a molecular weight of 442.47 g/mol. Its IUPAC name is [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate.
Molecular Properties
| Compound Name | [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate |
| PubChem CID | 139075420 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate |
| SMILES | O.O=C(O[C@H](c1ccccc1)[C@H](OC(=O)c1ccncc1)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C26H20N2O4.H2O/c29-25(21-11-15-27-16-12-21)31-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)32-26(30)22-13-17-28-18-14-22;/h1-18,23-24H;1H2/t23-,24-;/m1./s1 |
| InChIKey | KIIPBRRPDNWBTF-BNUOYOMZSA-N |
| XLogP | 4.15 |
| TPSA | 109.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate?
The IUPAC name of [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate (CID 139075420) is [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate.
What is the SMILES notation for [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate?
The canonical SMILES for [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate is O.O=C(O[C@H](c1ccccc1)[C@H](OC(=O)c1ccncc1)c1ccccc1)c1ccncc1.
What is the InChIKey of [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate?
The InChIKey is KIIPBRRPDNWBTF-BNUOYOMZSA-N. The full InChI is InChI=1S/C26H20N2O4.H2O/c29-25(21-11-15-27-16-12-21)31-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)32-26(30)22-13-17-28-18-14-22;/h1-18,23-24H;1H2/t23-,24-;/m1./s1.
What are the key properties of [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate?
[(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate has a molecular weight of 442.47 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-1,2-diphenyl-2-(pyridine-4-carbonyloxy)ethyl] pyridine-4-carboxylate;hydrate is sourced from PubChem (CID 139075420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).