C19H22Cl2N2O2 — CID 139075515
(4R,5R)-1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine (PubChem CID 139075515) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is (4R,5R)-1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine.
| Compound Name | (4R,5R)-1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine |
|---|---|
| PubChem CID | 139075515 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (4R,5R)-1,3-bis(4-chlorophenyl)-4,5-diethoxyimidazolidine |
| SMILES | CCO[C@@H]1[C@@H](OCC)N(c2ccc(Cl)cc2)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-3-24-18-19(25-4-2)23(17-11-7-15(21)8-12-17)13-22(18)16-9-5-14(20)6-10-16/h5-12,18-19H,3-4,13H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | MSWJRYPPDATHDX-RTBURBONSA-N |
| XLogP | 5.00 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |