C20H40I4Si4 — CID 139075584
[(1Z,3Z)-1,4-diiodo-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane (PubChem CID 139075584) has the molecular formula C20H40I4Si4 and a molecular weight of 900.50 g/mol. Its IUPAC name is [(1Z,3Z)-1,4-diiodo-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1Z,3Z)-1,4-diiodo-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 139075584 |
| Molecular Formula | C20H40I4Si4 |
| Molecular Weight | 900.50 g/mol |
| Exact Mass | 899.84 |
| IUPAC Name | [(1Z,3Z)-1,4-diiodo-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(I)=C/C=C(\I)[Si](C)(C)C.C[Si](C)(C)/C(I)=C/C=C(\I)[Si](C)(C)C |
| InChI | InChI=1S/2C10H20I2Si2/c2*1-13(2,3)9(11)7-8-10(12)14(4,5)6/h2*7-8H,1-6H3/b2*9-7+,10-8+ |
| InChIKey | PLLBFZJNXCIFLO-XTAIRRKCSA-N |
| XLogP | 10.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.50 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|