C28H34N2O4 — CID 139076280
(7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 139076280) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 139076280 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (7R,8R,8aS)-8-hydroxy-7-phenyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | O=C1CC[C@H]2[C@H](O)[C@@H](c3ccccc3)CCN12.O=C1CC[C@H]2[C@H](O)[C@@H](c3ccccc3)CCN12 |
| InChI | InChI=1S/2C14H17NO2/c2*16-13-7-6-12-14(17)11(8-9-15(12)13)10-4-2-1-3-5-10/h2*1-5,11-12,14,17H,6-9H2/t2*11-,12+,14-/m11/s1 |
| InChIKey | DXIYVMMUKHMSQA-QCTZVASKSA-N |
| XLogP | 3.05 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |