C16H17NO4 — CID 139076429
(E)-3-(3,4-dimethoxyphenyl)-1-pyridin-3-ylprop-2-en-1-one;hydrate (PubChem CID 139076429) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-pyridin-3-ylprop-2-en-1-one;hydrate.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-pyridin-3-ylprop-2-en-1-one;hydrate |
|---|---|
| PubChem CID | 139076429 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-pyridin-3-ylprop-2-en-1-one;hydrate |
| SMILES | COc1ccc(/C=C/C(=O)c2cccnc2)cc1OC.O |
| InChI | InChI=1S/C16H15NO3.H2O/c1-19-15-8-6-12(10-16(15)20-2)5-7-14(18)13-4-3-9-17-11-13;/h3-11H,1-2H3;1H2/b7-5+; |
| InChIKey | AETCYLQLRRRKGG-GZOLSCHFSA-N |
| XLogP | 2.17 |
| TPSA | 79.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|