C40H34N6 — CID 139076438
(4R)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine;(4S)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine (PubChem CID 139076438) has the molecular formula C40H34N6 and a molecular weight of 598.75 g/mol. Its IUPAC name is (4R)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine;(4S)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine.
| Compound Name | (4R)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine;(4S)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine |
|---|---|
| PubChem CID | 139076438 |
| Molecular Formula | C40H34N6 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | (4R)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine;(4S)-2,4-diphenyl-4,5-dihydro-3H-pyrido[2,3-b][1,4]diazepine |
| SMILES | c1ccc(C2=Nc3cccnc3N[C@@H](c3ccccc3)C2)cc1.c1ccc(C2=Nc3cccnc3N[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/2C20H17N3/c2*1-3-8-15(9-4-1)18-14-19(16-10-5-2-6-11-16)23-20-17(22-18)12-7-13-21-20/h2*1-13,19H,14H2,(H,21,23)/t2*19-/m10/s1 |
| InChIKey | NDLYTLZHLHSWKE-OYPHMNEHSA-N |
| XLogP | 9.52 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |