C18H18F6N3OP — CID 139076581
(5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium hexafluorophosphate (PubChem CID 139076581) has the molecular formula C18H18F6N3OP and a molecular weight of 437.32 g/mol. Its IUPAC name is (5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium hexafluorophosphate.
| Compound Name | (5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium hexafluorophosphate |
|---|---|
| PubChem CID | 139076581 |
| Molecular Formula | C18H18F6N3OP |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.c1ccc(C[C@H]2COCc3nn(-c4ccccc4)c[n+]32)cc1 |
| InChI | InChI=1S/C18H18N3O.F6P/c1-3-7-15(8-4-1)11-17-12-22-13-18-19-21(14-20(17)18)16-9-5-2-6-10-16;1-7(2,3,4,5)6/h1-10,14,17H,11-13H2;/q+1;-1/t17-;/m0./s1 |
| InChIKey | DZEKLXGXLTWRHN-LMOVPXPDSA-N |
| XLogP | 5.86 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|