C13H9Br2NO5 — CID 139076640
2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;1-pyridin-1-ium-2-ylethanone (PubChem CID 139076640) has the molecular formula C13H9Br2NO5 and a molecular weight of 419.03 g/mol. Its IUPAC name is 2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;1-pyridin-1-ium-2-ylethanone.
| Compound Name | 2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;1-pyridin-1-ium-2-ylethanone |
|---|---|
| PubChem CID | 139076640 |
| Molecular Formula | C13H9Br2NO5 |
| Molecular Weight | 419.03 g/mol |
| Exact Mass | 416.88 |
| IUPAC Name | 2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;1-pyridin-1-ium-2-ylethanone |
| SMILES | CC(=O)c1cccc[nH+]1.O=C1C(O)=C(Br)C(=O)C([O-])=C1Br |
| InChI | InChI=1S/C7H7NO.C6H2Br2O4/c1-6(9)7-4-2-3-5-8-7;7-1-3(9)5(11)2(8)6(12)4(1)10/h2-5H,1H3;9,12H |
| InChIKey | LJFQCMNPXATWRP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.03 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|