C34H32N2O6 — CID 139076695
4-[10-(4-carboxyphenyl)anthracen-9-yl]benzoic acid;bis(N,N-dimethylformamide) (PubChem CID 139076695) has the molecular formula C34H32N2O6 and a molecular weight of 564.64 g/mol. Its IUPAC name is 4-[10-(4-carboxyphenyl)anthracen-9-yl]benzoic acid;bis(N,N-dimethylformamide).
| Compound Name | 4-[10-(4-carboxyphenyl)anthracen-9-yl]benzoic acid;bis(N,N-dimethylformamide) |
|---|---|
| PubChem CID | 139076695 |
| Molecular Formula | C34H32N2O6 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 4-[10-(4-carboxyphenyl)anthracen-9-yl]benzoic acid;bis(N,N-dimethylformamide) |
| SMILES | CN(C)C=O.CN(C)C=O.O=C(O)c1ccc(-c2c3ccccc3c(-c3ccc(C(=O)O)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H18O4.2C3H7NO/c29-27(30)19-13-9-17(10-14-19)25-21-5-1-2-6-22(21)26(24-8-4-3-7-23(24)25)18-11-15-20(16-12-18)28(31)32;2*1-4(2)3-5/h1-16H,(H,29,30)(H,31,32);2*3H,1-2H3 |
| InChIKey | AXBCXBIYPPLDGZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|