C19H14ClCuN3O3 — CID 139076810
copper;(NE,1Z)-5-chloro-2-hydroxy-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;pyridine (PubChem CID 139076810) has the molecular formula C19H14ClCuN3O3 and a molecular weight of 431.34 g/mol. Its IUPAC name is copper;(NE,1Z)-5-chloro-2-hydroxy-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;pyridine.
| Compound Name | copper;(NE,1Z)-5-chloro-2-hydroxy-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;pyridine |
|---|---|
| PubChem CID | 139076810 |
| Molecular Formula | C19H14ClCuN3O3 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | copper;(NE,1Z)-5-chloro-2-hydroxy-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;pyridine |
| SMILES | [Cu+2].[O-]/C(=N\N=C\c1ccccc1[O-])c1cc(Cl)ccc1O.c1ccncc1 |
| InChI | InChI=1S/C14H11ClN2O3.C5H5N.Cu/c15-10-5-6-13(19)11(7-10)14(20)17-16-8-9-3-1-2-4-12(9)18;1-2-4-6-5-3-1;/h1-8,18-19H,(H,17,20);1-5H;/q;;+2/p-2/b16-8+;; |
| InChIKey | ADOMDLJKTLXUGE-RFZNCAAWSA-L |
| XLogP | 2.34 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|