About [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate
[6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate (PubChem CID 139076861) has the molecular formula C30H38O4S
and a molecular weight of 494.70 g/mol. Its IUPAC name is [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate.
Molecular Properties
| Compound Name | [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate |
| PubChem CID | 139076861 |
| Molecular Formula | C30H38O4S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(-c2c(C)c(C)cc(C(C)(C)C)c2OS(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C30H38O4S/c1-18-16-23(29(5,6)7)27(31)25(20(18)3)26-21(4)19(2)17-24(30(8,9)10)28(26)34-35(32,33)22-14-12-11-13-15-22/h11-17,31H,1-10H3 |
| InChIKey | AAJOGBUKENHMNR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate?
The IUPAC name of [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate (CID 139076861) is [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate.
What is the SMILES notation for [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate?
The canonical SMILES for [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate is Cc1cc(C(C)(C)C)c(O)c(-c2c(C)c(C)cc(C(C)(C)C)c2OS(=O)(=O)c2ccccc2)c1C.
What is the InChIKey of [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate?
The InChIKey is AAJOGBUKENHMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H38O4S/c1-18-16-23(29(5,6)7)27(31)25(20(18)3)26-21(4)19(2)17-24(30(8,9)10)28(26)34-35(32,33)22-14-12-11-13-15-22/h11-17,31H,1-10H3.
What are the key properties of [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate?
[6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate has a molecular weight of 494.70 g/mol, XLogP of 7.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-tert-butyl-2-(3-tert-butyl-2-hydroxy-5,6-dimethylphenyl)-3,4-dimethylphenyl] benzenesulfonate is sourced from PubChem (CID 139076861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).