C22H19ClN2O3S — CID 139077045
4-chlorobenzenesulfonate;3-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-1H-indole (PubChem CID 139077045) has the molecular formula C22H19ClN2O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is 4-chlorobenzenesulfonate;3-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-1H-indole.
| Compound Name | 4-chlorobenzenesulfonate;3-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-1H-indole |
|---|---|
| PubChem CID | 139077045 |
| Molecular Formula | C22H19ClN2O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-chlorobenzenesulfonate;3-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]-1H-indole |
| SMILES | C[n+]1ccccc1/C=C/c1c[nH]c2ccccc12.O=S(=O)([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14N2.C6H5ClO3S/c1-18-11-5-4-6-14(18)10-9-13-12-17-16-8-3-2-7-15(13)16;7-5-1-3-6(4-2-5)11(8,9)10/h2-12H,1H3;1-4H,(H,8,9,10) |
| InChIKey | XXKMEOBXRSCRGR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|