About 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole
2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole (PubChem CID 139077171) has the molecular formula C28H16S8
and a molecular weight of 608.97 g/mol. Its IUPAC name is 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole.
Molecular Properties
| Compound Name | 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole |
| PubChem CID | 139077171 |
| Molecular Formula | C28H16S8 |
| Molecular Weight | 608.97 g/mol |
| Exact Mass | 607.90 |
| IUPAC Name | 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole |
| SMILES | c1ccc2c(c1)SC(=C1Sc3ccccc3S1)S2.c1ccc2c(c1)SC(=C1Sc3ccccc3S1)S2 |
| InChI | InChI=1S/2C14H8S4/c2*1-2-6-10-9(5-1)15-13(16-10)14-17-11-7-3-4-8-12(11)18-14/h2*1-8H |
| InChIKey | JJHYRJXNMGWTHK-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.97 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole?
The IUPAC name of 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole (CID 139077171) is 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole.
What is the SMILES notation for 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole?
The canonical SMILES for 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole is c1ccc2c(c1)SC(=C1Sc3ccccc3S1)S2.c1ccc2c(c1)SC(=C1Sc3ccccc3S1)S2.
What is the InChIKey of 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole?
The InChIKey is JJHYRJXNMGWTHK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H8S4/c2*1-2-6-10-9(5-1)15-13(16-10)14-17-11-7-3-4-8-12(11)18-14/h2*1-8H.
What are the key properties of 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole?
2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole has a molecular weight of 608.97 g/mol, XLogP of 11.82, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodithiol-2-ylidene)-1,3-benzodithiole is sourced from PubChem (CID 139077171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).