C26H24N2O4 — CID 139077323
2,6-bis(1-ethynylcyclohexyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 139077323) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2,6-bis(1-ethynylcyclohexyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(1-ethynylcyclohexyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 139077323 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2,6-bis(1-ethynylcyclohexyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | C#CC1(n2c(=O)c3cc4c(=O)n(C5(C#C)CCCCC5)c(=O)c4cc3c2=O)CCCCC1 |
| InChI | InChI=1S/C26H24N2O4/c1-3-25(11-7-5-8-12-25)27-21(29)17-15-19-20(16-18(17)22(27)30)24(32)28(23(19)31)26(4-2)13-9-6-10-14-26/h1-2,15-16H,5-14H2 |
| InChIKey | CLQRUPOLBADTDM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|