C30H30N2O6 — CID 139077325
6,13-bis(1-acetylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 139077325) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is 6,13-bis(1-acetylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(1-acetylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 139077325 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 6,13-bis(1-acetylcyclohexyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CC(=O)C1(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(C2(C(C)=O)CCCCC2)C4=O)CCCCC1 |
| InChI | InChI=1S/C30H30N2O6/c1-17(33)29(13-5-3-6-14-29)31-25(35)19-9-11-21-24-22(12-10-20(23(19)24)26(31)36)28(38)32(27(21)37)30(18(2)34)15-7-4-8-16-30/h9-12H,3-8,13-16H2,1-2H3 |
| InChIKey | DGQFJGMBXMMPIN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|