C22H16Cl2N6O4 — CID 139077444
bis(acetonitrile);2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(pyridine-3-carbonitrile) (PubChem CID 139077444) has the molecular formula C22H16Cl2N6O4 and a molecular weight of 499.31 g/mol. Its IUPAC name is bis(acetonitrile);2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(pyridine-3-carbonitrile).
| Compound Name | bis(acetonitrile);2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(pyridine-3-carbonitrile) |
|---|---|
| PubChem CID | 139077444 |
| Molecular Formula | C22H16Cl2N6O4 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | bis(acetonitrile);2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione;bis(pyridine-3-carbonitrile) |
| SMILES | CC#N.CC#N.N#Cc1cccnc1.N#Cc1cccnc1.O=C1C(O)=C(Cl)C(=O)C(O)=C1Cl |
| InChI | InChI=1S/C6H2Cl2O4.2C6H4N2.2C2H3N/c7-1-3(9)5(11)2(8)6(12)4(1)10;2*7-4-6-2-1-3-8-5-6;2*1-2-3/h9,12H;2*1-3,5H;2*1H3 |
| InChIKey | ZJCUJEYZDYKXHW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 195.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|