C29H29ClN2O7 — CID 139077447
(3R,4S,5R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(4-chlorophenyl)-4-nitro-2-phenyl-1,2-oxazolidine (PubChem CID 139077447) has the molecular formula C29H29ClN2O7 and a molecular weight of 553.01 g/mol. Its IUPAC name is (3R,4S,5R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(4-chlorophenyl)-4-nitro-2-phenyl-1,2-oxazolidine.
| Compound Name | (3R,4S,5R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(4-chlorophenyl)-4-nitro-2-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 139077447 |
| Molecular Formula | C29H29ClN2O7 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | (3R,4S,5R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-5-(4-chlorophenyl)-4-nitro-2-phenyl-1,2-oxazolidine |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3[C@H]([N+](=O)[O-])[C@@H](c4ccc(Cl)cc4)ON3c3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C29H29ClN2O7/c1-29(2)37-27-26(35-17-18-9-5-3-6-10-18)25(36-28(27)38-29)22-23(32(33)34)24(19-13-15-20(30)16-14-19)39-31(22)21-11-7-4-8-12-21/h3-16,22-28H,17H2,1-2H3/t22-,23+,24-,25-,26+,27-,28-/m1/s1 |
| InChIKey | HVFQYAYDNVMHSV-RIPUTQHHSA-N |
| XLogP | 5.31 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|