C24H18CuN4O6S2 — CID 139077452
copper bis(2-(pyridin-2-ylmethylideneamino)benzenesulfonate) (PubChem CID 139077452) has the molecular formula C24H18CuN4O6S2 and a molecular weight of 586.11 g/mol. Its IUPAC name is copper bis(2-(pyridin-2-ylmethylideneamino)benzenesulfonate).
| Compound Name | copper bis(2-(pyridin-2-ylmethylideneamino)benzenesulfonate) |
|---|---|
| PubChem CID | 139077452 |
| Molecular Formula | C24H18CuN4O6S2 |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.00 |
| IUPAC Name | copper bis(2-(pyridin-2-ylmethylideneamino)benzenesulfonate) |
| SMILES | O=S(=O)([O-])c1ccccc1/N=C/c1ccccn1.O=S(=O)([O-])c1ccccc1/N=C/c1ccccn1.[Cu+2] |
| InChI | InChI=1S/2C12H10N2O3S.Cu/c2*15-18(16,17)12-7-2-1-6-11(12)14-9-10-5-3-4-8-13-10;/h2*1-9H,(H,15,16,17);/q;;+2/p-2/b2*14-9+; |
| InChIKey | CUFZGZSBRFKMTB-ZNVPEIAMSA-L |
| XLogP | 3.47 |
| TPSA | 164.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|