C25H19CuN5O3 — CID 139077492
copper;2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]acetate;2-pyridin-2-ylpyridine (PubChem CID 139077492) has the molecular formula C25H19CuN5O3 and a molecular weight of 501.01 g/mol. Its IUPAC name is copper;2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]acetate;2-pyridin-2-ylpyridine.
| Compound Name | copper;2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]acetate;2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139077492 |
| Molecular Formula | C25H19CuN5O3 |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | copper;2-[(2-oxido-5-phenyldiazenylphenyl)methylideneamino]acetate;2-pyridin-2-ylpyridine |
| SMILES | O=C([O-])CN=Cc1cc(/N=N/c2ccccc2)ccc1[O-].[Cu+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C15H13N3O3.C10H8N2.Cu/c19-14-7-6-13(8-11(14)9-16-10-15(20)21)18-17-12-4-2-1-3-5-12;1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-9,19H,10H2,(H,20,21);1-8H;/q;;+2/p-2/b16-9?,18-17+;; |
| InChIKey | QMKOXRIAFCYUDL-XSTMPEESSA-L |
| XLogP | 3.49 |
| TPSA | 126.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|