C19H16N2O2 — CID 139077716
2-(hydroxymethyl)phenol;1,10-phenanthroline (PubChem CID 139077716) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(hydroxymethyl)phenol;1,10-phenanthroline.
| Compound Name | 2-(hydroxymethyl)phenol;1,10-phenanthroline |
|---|---|
| PubChem CID | 139077716 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(hydroxymethyl)phenol;1,10-phenanthroline |
| SMILES | OCc1ccccc1O.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C7H8O2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-5-6-3-1-2-4-7(6)9/h1-8H;1-4,8-9H,5H2 |
| InChIKey | GRBZMINPNCYWFN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|