About 4-aminobenzoate;1H-imidazol-3-ium
4-aminobenzoate;1H-imidazol-3-ium (PubChem CID 139077863) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-aminobenzoate;1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 4-aminobenzoate;1H-imidazol-3-ium |
| PubChem CID | 139077863 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-aminobenzoate;1H-imidazol-3-ium |
| SMILES | Nc1ccc(C(=O)[O-])cc1.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C7H7NO2.C3H4N2/c8-6-3-1-5(2-4-6)7(9)10;1-2-5-3-4-1/h1-4H,8H2,(H,9,10);1-3H,(H,4,5) |
| InChIKey | GISKEXNVGXGGMO-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzoate;1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzoate;1H-imidazol-3-ium?
The IUPAC name of 4-aminobenzoate;1H-imidazol-3-ium (CID 139077863) is 4-aminobenzoate;1H-imidazol-3-ium.
What is the SMILES notation for 4-aminobenzoate;1H-imidazol-3-ium?
The canonical SMILES for 4-aminobenzoate;1H-imidazol-3-ium is Nc1ccc(C(=O)[O-])cc1.c1c[nH+]c[nH]1.
What is the InChIKey of 4-aminobenzoate;1H-imidazol-3-ium?
The InChIKey is GISKEXNVGXGGMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C3H4N2/c8-6-3-1-5(2-4-6)7(9)10;1-2-5-3-4-1/h1-4H,8H2,(H,9,10);1-3H,(H,4,5).
What are the key properties of 4-aminobenzoate;1H-imidazol-3-ium?
4-aminobenzoate;1H-imidazol-3-ium has a molecular weight of 205.22 g/mol, XLogP of -0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzoate;1H-imidazol-3-ium is sourced from PubChem (CID 139077863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).