C11H9Cl2NO6 — CID 139078016
2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-ol;hydrate (PubChem CID 139078016) has the molecular formula C11H9Cl2NO6 and a molecular weight of 322.10 g/mol. Its IUPAC name is 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-ol;hydrate.
| Compound Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-ol;hydrate |
|---|---|
| PubChem CID | 139078016 |
| Molecular Formula | C11H9Cl2NO6 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium-3-ol;hydrate |
| SMILES | O.O=C1C(O)=C(Cl)C(=O)C([O-])=C1Cl.Oc1ccc[nH+]c1 |
| InChI | InChI=1S/C6H2Cl2O4.C5H5NO.H2O/c7-1-3(9)5(11)2(8)6(12)4(1)10;7-5-2-1-3-6-4-5;/h9,12H;1-4,7H;1H2 |
| InChIKey | MFODNBBEMYCHSE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|