About 7-chloro-1H-indole-2,3-dione
7-chloro-1H-indole-2,3-dione (PubChem CID 139078100) has the molecular formula C16H8Cl2N2O4
and a molecular weight of 363.16 g/mol. Its IUPAC name is 7-chloro-1H-indole-2,3-dione.
Molecular Properties
| Compound Name | 7-chloro-1H-indole-2,3-dione |
| PubChem CID | 139078100 |
| Molecular Formula | C16H8Cl2N2O4 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 7-chloro-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(Cl)cccc2C1=O.O=C1Nc2c(Cl)cccc2C1=O |
| InChI | InChI=1S/2C8H4ClNO2/c2*9-5-3-1-2-4-6(5)10-8(12)7(4)11/h2*1-3H,(H,10,11,12) |
| InChIKey | OTOKVOJEINGIBY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1H-indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1H-indole-2,3-dione?
The IUPAC name of 7-chloro-1H-indole-2,3-dione (CID 139078100) is 7-chloro-1H-indole-2,3-dione.
What is the SMILES notation for 7-chloro-1H-indole-2,3-dione?
The canonical SMILES for 7-chloro-1H-indole-2,3-dione is O=C1Nc2c(Cl)cccc2C1=O.O=C1Nc2c(Cl)cccc2C1=O.
What is the InChIKey of 7-chloro-1H-indole-2,3-dione?
The InChIKey is OTOKVOJEINGIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H4ClNO2/c2*9-5-3-1-2-4-6(5)10-8(12)7(4)11/h2*1-3H,(H,10,11,12).
What are the key properties of 7-chloro-1H-indole-2,3-dione?
7-chloro-1H-indole-2,3-dione has a molecular weight of 363.16 g/mol, XLogP of 2.95, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1H-indole-2,3-dione is sourced from PubChem (CID 139078100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).