C16H8Cl2N2O4 — CID 139078100
7-chloro-1H-indole-2,3-dione (PubChem CID 139078100) has the molecular formula C16H8Cl2N2O4 and a molecular weight of 363.16 g/mol. Its IUPAC name is 7-chloro-1H-indole-2,3-dione.
| Compound Name | 7-chloro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 139078100 |
| Molecular Formula | C16H8Cl2N2O4 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 7-chloro-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(Cl)cccc2C1=O.O=C1Nc2c(Cl)cccc2C1=O |
| InChI | InChI=1S/2C8H4ClNO2/c2*9-5-3-1-2-4-6(5)10-8(12)7(4)11/h2*1-3H,(H,10,11,12) |
| InChIKey | OTOKVOJEINGIBY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|