About copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate
copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate (PubChem CID 139078128) has the molecular formula C12H8CuN2O6
and a molecular weight of 339.75 g/mol. Its IUPAC name is copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate.
Molecular Properties
| Compound Name | copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate |
| PubChem CID | 139078128 |
| Molecular Formula | C12H8CuN2O6 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate |
| SMILES | O.O=C([O-])c1cccc(Oc2cccc(C(=O)[O-])n2)n1.[Cu+2] |
| InChI | InChI=1S/C12H8N2O5.Cu.H2O/c15-11(16)7-3-1-5-9(13-7)19-10-6-2-4-8(14-10)12(17)18;;/h1-6H,(H,15,16)(H,17,18);;1H2/q;+2;/p-2 |
| InChIKey | UELAGQIUPQGQQF-UHFFFAOYSA-L |
| XLogP | -1.83 |
| TPSA | 146.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate?
The IUPAC name of copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate (CID 139078128) is copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate.
What is the SMILES notation for copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate?
The canonical SMILES for copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate is O.O=C([O-])c1cccc(Oc2cccc(C(=O)[O-])n2)n1.[Cu+2].
What is the InChIKey of copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate?
The InChIKey is UELAGQIUPQGQQF-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N2O5.Cu.H2O/c15-11(16)7-3-1-5-9(13-7)19-10-6-2-4-8(14-10)12(17)18;;/h1-6H,(H,15,16)(H,17,18);;1H2/q;+2;/p-2.
What are the key properties of copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate?
copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate has a molecular weight of 339.75 g/mol, XLogP of -1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for copper;6-[(6-carboxylato-2-pyridinyl)oxy]pyridine-2-carboxylate;hydrate is sourced from PubChem (CID 139078128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).