C16H20N2O9 — CID 139078141
1,10-phenanthrolin-10-ium;(2S,3S)-2,3,4-trihydroxy-4-oxobutanoate;trihydrate (PubChem CID 139078141) has the molecular formula C16H20N2O9 and a molecular weight of 384.34 g/mol. Its IUPAC name is 1,10-phenanthrolin-10-ium;(2S,3S)-2,3,4-trihydroxy-4-oxobutanoate;trihydrate.
| Compound Name | 1,10-phenanthrolin-10-ium;(2S,3S)-2,3,4-trihydroxy-4-oxobutanoate;trihydrate |
|---|---|
| PubChem CID | 139078141 |
| Molecular Formula | C16H20N2O9 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1,10-phenanthrolin-10-ium;(2S,3S)-2,3,4-trihydroxy-4-oxobutanoate;trihydrate |
| SMILES | O.O.O.O=C([O-])[C@@H](O)[C@H](O)C(=O)O.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8N2.C4H6O6.3H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;5-1(3(7)8)2(6)4(9)10;;;/h1-8H;1-2,5-6H,(H,7,8)(H,9,10);3*1H2/t;1-,2-;;;/m.0.../s1 |
| InChIKey | FNUZQEWIIIZKHG-DJEQASHRSA-N |
| XLogP | -3.73 |
| TPSA | 239.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|