C20H34O2Si — CID 139078270
(1S,4R,7R,9R,12S)-1-[tert-butyl(dimethyl)silyl]oxy-4,9-dimethyltetracyclo[5.4.1.04,12.09,12]dodecan-6-one (PubChem CID 139078270) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (1S,4R,7R,9R,12S)-1-[tert-butyl(dimethyl)silyl]oxy-4,9-dimethyltetracyclo[5.4.1.04,12.09,12]dodecan-6-one.
| Compound Name | (1S,4R,7R,9R,12S)-1-[tert-butyl(dimethyl)silyl]oxy-4,9-dimethyltetracyclo[5.4.1.04,12.09,12]dodecan-6-one |
|---|---|
| PubChem CID | 139078270 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (1S,4R,7R,9R,12S)-1-[tert-butyl(dimethyl)silyl]oxy-4,9-dimethyltetracyclo[5.4.1.04,12.09,12]dodecan-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CC[C@]3(C)CC(=O)[C@@H]4C[C@@](C)(CC1)[C@@]432 |
| InChI | InChI=1S/C20H34O2Si/c1-16(2,3)23(6,7)22-19-10-8-17(4)12-14-15(21)13-18(5,9-11-19)20(14,17)19/h14H,8-13H2,1-7H3/t14-,17+,18+,19-,20-/m0/s1 |
| InChIKey | UHMQGLXHOINQCM-UYYRZJCPSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|