About 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide
3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide (PubChem CID 139078335) has the molecular formula C47H44BINOP
and a molecular weight of 807.57 g/mol. Its IUPAC name is 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide |
| PubChem CID | 139078335 |
| Molecular Formula | C47H44BINOP |
| Molecular Weight | 807.57 g/mol |
| Exact Mass | 807.23 |
| IUPAC Name | 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide |
| SMILES | O=C(CI)NCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C23H23INOP/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;24-19-23(26)25-17-10-18-27(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-20H;1-9,11-16H,10,17-19H2/q-1;/p+1 |
| InChIKey | DCLFNHAWRNUMEP-UHFFFAOYSA-O |
| XLogP | 6.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 807.57 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide?
The IUPAC name of 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide (CID 139078335) is 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide.
What is the SMILES notation for 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide?
The canonical SMILES for 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide is O=C(CI)NCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide?
The InChIKey is DCLFNHAWRNUMEP-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H20B.C23H23INOP/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;24-19-23(26)25-17-10-18-27(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-20H;1-9,11-16H,10,17-19H2/q-1;/p+1.
What are the key properties of 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide?
3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide has a molecular weight of 807.57 g/mol, XLogP of 6.99, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-iodoacetyl)amino]propyl-triphenylphosphanium;tetraphenylboranuide is sourced from PubChem (CID 139078335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).