C18H16Br2N4 — CID 139078883
2-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]butane-2,3-diimine (PubChem CID 139078883) has the molecular formula C18H16Br2N4 and a molecular weight of 448.16 g/mol. Its IUPAC name is 2-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]butane-2,3-diimine |
|---|---|
| PubChem CID | 139078883 |
| Molecular Formula | C18H16Br2N4 |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | 2-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]butane-2,3-diimine |
| SMILES | CC(=N\N=C\c1ccc(Br)cc1)/C(C)=N/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16Br2N4/c1-13(23-21-11-15-3-7-17(19)8-4-15)14(2)24-22-12-16-5-9-18(20)10-6-16/h3-12H,1-2H3/b21-11+,22-12+,23-13+,24-14+ |
| InChIKey | UZSUXUDTBQSWEY-PIAWNXAWSA-N |
| XLogP | 5.50 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|