C26H31NO12 — CID 139078982
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-ethyl-8-methoxy-2-oxo-1H-quinolin-4-yl)oxy]oxan-2-yl]methyl acetate (PubChem CID 139078982) has the molecular formula C26H31NO12 and a molecular weight of 549.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-ethyl-8-methoxy-2-oxo-1H-quinolin-4-yl)oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-ethyl-8-methoxy-2-oxo-1H-quinolin-4-yl)oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139078982 |
| Molecular Formula | C26H31NO12 |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-ethyl-8-methoxy-2-oxo-1H-quinolin-4-yl)oxy]oxan-2-yl]methyl acetate |
| SMILES | CCc1c(O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c2cccc(OC)c2[nH]c1=O |
| InChI | InChI=1S/C26H31NO12/c1-7-16-21(17-9-8-10-18(33-6)20(17)27-25(16)32)39-26-24(37-15(5)31)23(36-14(4)30)22(35-13(3)29)19(38-26)11-34-12(2)28/h8-10,19,22-24,26H,7,11H2,1-6H3,(H,27,32)/t19-,22-,23+,24-,26+/m1/s1 |
| InChIKey | OQMMIMUOCBJCSS-MNDUUMEHSA-N |
| XLogP | 1.56 |
| TPSA | 165.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|