C20H34Br2O3 — CID 139079074
(1R,4S,4aS,7R,8aR)-4-bromo-7-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-1,4a-dimethyl-2,3,4,5,6,8-hexahydronaphthalene-1,7,8a-triol (PubChem CID 139079074) has the molecular formula C20H34Br2O3 and a molecular weight of 482.30 g/mol. Its IUPAC name is (1R,4S,4aS,7R,8aR)-4-bromo-7-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-1,4a-dimethyl-2,3,4,5,6,8-hexahydronaphthalene-1,7,8a-triol.
| Compound Name | (1R,4S,4aS,7R,8aR)-4-bromo-7-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-1,4a-dimethyl-2,3,4,5,6,8-hexahydronaphthalene-1,7,8a-triol |
|---|---|
| PubChem CID | 139079074 |
| Molecular Formula | C20H34Br2O3 |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (1R,4S,4aS,7R,8aR)-4-bromo-7-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-1,4a-dimethyl-2,3,4,5,6,8-hexahydronaphthalene-1,7,8a-triol |
| SMILES | CC1(C)[C@H](Br)CC[C@]1(C)[C@@]1(O)CC[C@]2(C)[C@@H](Br)CC[C@@](C)(O)[C@@]2(O)C1 |
| InChI | InChI=1S/C20H34Br2O3/c1-15(2)13(21)6-8-17(15,4)19(24)11-10-16(3)14(22)7-9-18(5,23)20(16,25)12-19/h13-14,23-25H,6-12H2,1-5H3/t13-,14+,16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | DYZRLIZHMYKGFR-VWFOVLTISA-N |
| XLogP | 4.54 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|