About 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one
6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one (PubChem CID 139079267) has the molecular formula C16H16Br2N6O2
and a molecular weight of 484.15 g/mol. Its IUPAC name is 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 139079267 |
| Molecular Formula | C16H16Br2N6O2 |
| Molecular Weight | 484.15 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(C)c2ncc(Br)cc21.Cn1c(=O)n(C)c2ncc(Br)cc21 |
| InChI | InChI=1S/2C8H8BrN3O/c2*1-11-6-3-5(9)4-10-7(6)12(2)8(11)13/h2*3-4H,1-2H3 |
| InChIKey | DNSOIEAFRAXDRG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one (CID 139079267) is 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one is Cn1c(=O)n(C)c2ncc(Br)cc21.Cn1c(=O)n(C)c2ncc(Br)cc21.
What is the InChIKey of 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
The InChIKey is DNSOIEAFRAXDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8BrN3O/c2*1-11-6-3-5(9)4-10-7(6)12(2)8(11)13/h2*3-4H,1-2H3.
What are the key properties of 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one has a molecular weight of 484.15 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-dimethylimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 139079267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).