C20H22Br2S2 — CID 139079277
13,15-dibromo-6,7,17,18-tetramethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene (PubChem CID 139079277) has the molecular formula C20H22Br2S2 and a molecular weight of 486.34 g/mol. Its IUPAC name is 13,15-dibromo-6,7,17,18-tetramethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene.
| Compound Name | 13,15-dibromo-6,7,17,18-tetramethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene |
|---|---|
| PubChem CID | 139079277 |
| Molecular Formula | C20H22Br2S2 |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | 13,15-dibromo-6,7,17,18-tetramethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(14),5,7,12,15,17-hexaene |
| SMILES | Cc1c(C)c2c(C)c(C)c1CSCc1cc(Br)c(cc1Br)CSC2 |
| InChI | InChI=1S/C20H22Br2S2/c1-11-12(2)18-10-24-8-16-6-19(21)15(5-20(16)22)7-23-9-17(11)13(3)14(18)4/h5-6H,7-10H2,1-4H3 |
| InChIKey | XMSCZKJXBHVFQS-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |