C22H25FO4 — CID 139079420
[(1S,2R,7R,9R,11R,12S)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 4-fluorobenzoate (PubChem CID 139079420) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is [(1S,2R,7R,9R,11R,12S)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 4-fluorobenzoate.
| Compound Name | [(1S,2R,7R,9R,11R,12S)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 139079420 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [(1S,2R,7R,9R,11R,12S)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 4-fluorobenzoate |
| SMILES | CC1=C[C@H]2O[C@@H]3C[C@@H](OC(=O)c4ccc(F)cc4)[C@](C)([C@@]2(C)CC1)[C@]31CO1 |
| InChI | InChI=1S/C22H25FO4/c1-13-8-9-20(2)16(10-13)26-18-11-17(21(20,3)22(18)12-25-22)27-19(24)14-4-6-15(23)7-5-14/h4-7,10,16-18H,8-9,11-12H2,1-3H3/t16-,17-,18-,20+,21-,22+/m1/s1 |
| InChIKey | LJVRRMFOACAWOW-XJQPKEKPSA-N |
| XLogP | 4.04 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|