C23H22N2O3 — CID 139079838
ethyl (4S)-6-amino-5-cyano-2,4-bis(4-methylphenyl)-4H-pyran-3-carboxylate (PubChem CID 139079838) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl (4S)-6-amino-5-cyano-2,4-bis(4-methylphenyl)-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4S)-6-amino-5-cyano-2,4-bis(4-methylphenyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 139079838 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl (4S)-6-amino-5-cyano-2,4-bis(4-methylphenyl)-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(C)cc2)OC(N)=C(C#N)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-4-27-23(26)20-19(16-9-5-14(2)6-10-16)18(13-24)22(25)28-21(20)17-11-7-15(3)8-12-17/h5-12,19H,4,25H2,1-3H3/t19-/m0/s1 |
| InChIKey | ZWIRSXPJKWGBKX-IBGZPJMESA-N |
| XLogP | 4.09 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |