C32H32Cl4N4 — CID 139080012
(1R,12S)-6,7-dichloro-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene (PubChem CID 139080012) has the molecular formula C32H32Cl4N4 and a molecular weight of 614.45 g/mol. Its IUPAC name is (1R,12S)-6,7-dichloro-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene.
| Compound Name | (1R,12S)-6,7-dichloro-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139080012 |
| Molecular Formula | C32H32Cl4N4 |
| Molecular Weight | 614.45 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | (1R,12S)-6,7-dichloro-1,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1nc3cc(Cl)c(Cl)cc3nc12.CC1(C)[C@@H]2CC[C@@]1(C)c1nc3cc(Cl)c(Cl)cc3nc12 |
| InChI | InChI=1S/2C16H16Cl2N2/c2*1-15(2)8-4-5-16(15,3)14-13(8)19-11-6-9(17)10(18)7-12(11)20-14/h2*6-8H,4-5H2,1-3H3/t2*8-,16+/m11/s1 |
| InChIKey | MKMACTXCYJQQMO-RRSRSRPUSA-N |
| XLogP | 10.22 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.45 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |