C10H19NO4 — CID 139080075
(6S,7S,8S,8aS)-6-ethyl-7,8-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one;hydrate (PubChem CID 139080075) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (6S,7S,8S,8aS)-6-ethyl-7,8-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one;hydrate.
| Compound Name | (6S,7S,8S,8aS)-6-ethyl-7,8-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one;hydrate |
|---|---|
| PubChem CID | 139080075 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (6S,7S,8S,8aS)-6-ethyl-7,8-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one;hydrate |
| SMILES | CC[C@H]1CN2C(=O)CC[C@H]2[C@H](O)[C@H]1O.O |
| InChI | InChI=1S/C10H17NO3.H2O/c1-2-6-5-11-7(3-4-8(11)12)10(14)9(6)13;/h6-7,9-10,13-14H,2-5H2,1H3;1H2/t6-,7-,9-,10-;/m0./s1 |
| InChIKey | WTTBGUCBJWBBQZ-MJHUFZJCSA-N |
| XLogP | -1.09 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |