About 5-pentyl-2H-tetrazole
5-pentyl-2H-tetrazole (PubChem CID 139080284) has the molecular formula C12H24N8
and a molecular weight of 280.38 g/mol. Its IUPAC name is 5-pentyl-2H-tetrazole.
Molecular Properties
| Compound Name | 5-pentyl-2H-tetrazole |
| PubChem CID | 139080284 |
| Molecular Formula | C12H24N8 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 5-pentyl-2H-tetrazole |
| SMILES | CCCCCc1nn[nH]n1.CCCCCc1nn[nH]n1 |
| InChI | InChI=1S/2C6H12N4/c2*1-2-3-4-5-6-7-9-10-8-6/h2*2-5H2,1H3,(H,7,8,9,10) |
| InChIKey | IPMHQKSWTVNCTB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentyl-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentyl-2H-tetrazole?
The IUPAC name of 5-pentyl-2H-tetrazole (CID 139080284) is 5-pentyl-2H-tetrazole.
What is the SMILES notation for 5-pentyl-2H-tetrazole?
The canonical SMILES for 5-pentyl-2H-tetrazole is CCCCCc1nn[nH]n1.CCCCCc1nn[nH]n1.
What is the InChIKey of 5-pentyl-2H-tetrazole?
The InChIKey is IPMHQKSWTVNCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12N4/c2*1-2-3-4-5-6-7-9-10-8-6/h2*2-5H2,1H3,(H,7,8,9,10).
What are the key properties of 5-pentyl-2H-tetrazole?
5-pentyl-2H-tetrazole has a molecular weight of 280.38 g/mol, XLogP of 1.86, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentyl-2H-tetrazole is sourced from PubChem (CID 139080284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).