About 5-nitro-1H-1,2,4-triazole
5-nitro-1H-1,2,4-triazole (PubChem CID 139080324) has the molecular formula C4H4N8O4
and a molecular weight of 228.13 g/mol. Its IUPAC name is 5-nitro-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-nitro-1H-1,2,4-triazole |
| PubChem CID | 139080324 |
| Molecular Formula | C4H4N8O4 |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 5-nitro-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ncn[nH]1.O=[N+]([O-])c1ncn[nH]1 |
| InChI | InChI=1S/2C2H2N4O2/c2*7-6(8)2-3-1-4-5-2/h2*1H,(H,3,4,5) |
| InChIKey | AUOVJYKEYXOIJD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1H-1,2,4-triazole?
The IUPAC name of 5-nitro-1H-1,2,4-triazole (CID 139080324) is 5-nitro-1H-1,2,4-triazole.
What is the SMILES notation for 5-nitro-1H-1,2,4-triazole?
The canonical SMILES for 5-nitro-1H-1,2,4-triazole is O=[N+]([O-])c1ncn[nH]1.O=[N+]([O-])c1ncn[nH]1.
What is the InChIKey of 5-nitro-1H-1,2,4-triazole?
The InChIKey is AUOVJYKEYXOIJD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H2N4O2/c2*7-6(8)2-3-1-4-5-2/h2*1H,(H,3,4,5).
What are the key properties of 5-nitro-1H-1,2,4-triazole?
5-nitro-1H-1,2,4-triazole has a molecular weight of 228.13 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1H-1,2,4-triazole is sourced from PubChem (CID 139080324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).