C40H32Cl2N2O2 — CID 139080842
(E)-3-(4-chlorophenyl)-1-(2,4-dimethylquinolin-3-yl)prop-2-en-1-one (PubChem CID 139080842) has the molecular formula C40H32Cl2N2O2 and a molecular weight of 643.61 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-(2,4-dimethylquinolin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-(2,4-dimethylquinolin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139080842 |
| Molecular Formula | C40H32Cl2N2O2 |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-(2,4-dimethylquinolin-3-yl)prop-2-en-1-one |
| SMILES | Cc1nc2ccccc2c(C)c1C(=O)/C=C/c1ccc(Cl)cc1.Cc1nc2ccccc2c(C)c1C(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C20H16ClNO/c2*1-13-17-5-3-4-6-18(17)22-14(2)20(13)19(23)12-9-15-7-10-16(21)11-8-15/h2*3-12H,1-2H3/b2*12-9+ |
| InChIKey | YGQITHGRNZHDEB-MTTRIGNLSA-N |
| XLogP | 10.80 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|