C16H16N6O2S2 — CID 139081051
5-phenyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)disulfanyl]-1H-1,2,4-triazole;dihydrate (PubChem CID 139081051) has the molecular formula C16H16N6O2S2 and a molecular weight of 388.48 g/mol. Its IUPAC name is 5-phenyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)disulfanyl]-1H-1,2,4-triazole;dihydrate.
| Compound Name | 5-phenyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)disulfanyl]-1H-1,2,4-triazole;dihydrate |
|---|---|
| PubChem CID | 139081051 |
| Molecular Formula | C16H16N6O2S2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 5-phenyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)disulfanyl]-1H-1,2,4-triazole;dihydrate |
| SMILES | O.O.c1ccc(-c2nc(SSc3n[nH]c(-c4ccccc4)n3)n[nH]2)cc1 |
| InChI | InChI=1S/C16H12N6S2.2H2O/c1-3-7-11(8-4-1)13-17-15(21-19-13)23-24-16-18-14(20-22-16)12-9-5-2-6-10-12;;/h1-10H,(H,17,19,21)(H,18,20,22);2*1H2 |
| InChIKey | XOXUBZWQQYKQJN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|