C15H10BF2NO — CID 139081110
18,18-difluoro-17-oxa-1-azonia-18-boranuidatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15-octaene (PubChem CID 139081110) has the molecular formula C15H10BF2NO and a molecular weight of 269.06 g/mol. Its IUPAC name is 18,18-difluoro-17-oxa-1-azonia-18-boranuidatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15-octaene.
| Compound Name | 18,18-difluoro-17-oxa-1-azonia-18-boranuidatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 139081110 |
| Molecular Formula | C15H10BF2NO |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 18,18-difluoro-17-oxa-1-azonia-18-boranuidatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2,4,6,8,11,13,15-octaene |
| SMILES | F[B-]1(F)Oc2ccccc2-c2ccc3ccccc3[n+]21 |
| InChI | InChI=1S/C15H10BF2NO/c17-16(18)19-13-7-3-1-5-11(13)9-10-14(19)12-6-2-4-8-15(12)20-16/h1-10H |
| InChIKey | DCRRSJBJOBPKFD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|