About 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile
3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile (PubChem CID 139081268) has the molecular formula C14H10N2S5
and a molecular weight of 366.58 g/mol. Its IUPAC name is 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile.
Molecular Properties
| Compound Name | 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
| PubChem CID | 139081268 |
| Molecular Formula | C14H10N2S5 |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSC1=CS/C(=C2/SC=C(c3ccncc3)S2)S1 |
| InChI | InChI=1S/C14H10N2S5/c15-4-1-7-17-12-9-19-14(21-12)13-18-8-11(20-13)10-2-5-16-6-3-10/h2-3,5-6,8-9H,1,7H2/b14-13+ |
| InChIKey | SURZIDCKINTIHV-BUHFOSPRSA-N |
| XLogP | 5.91 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile?
The IUPAC name of 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile (CID 139081268) is 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile.
What is the SMILES notation for 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile?
The canonical SMILES for 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile is N#CCCSC1=CS/C(=C2/SC=C(c3ccncc3)S2)S1.
What is the InChIKey of 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile?
The InChIKey is SURZIDCKINTIHV-BUHFOSPRSA-N. The full InChI is InChI=1S/C14H10N2S5/c15-4-1-7-17-12-9-19-14(21-12)13-18-8-11(20-13)10-2-5-16-6-3-10/h2-3,5-6,8-9H,1,7H2/b14-13+.
What are the key properties of 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile?
3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile has a molecular weight of 366.58 g/mol, XLogP of 5.91, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2E)-2-(4-pyridin-4-yl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile is sourced from PubChem (CID 139081268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).