C27H20ClNO3 — CID 139081862
4'-(4-Chlorophenyl)-1'-methyldispiro[indan-2,2'-pyrrolidine-3',2''-indan]-1,3,1''-trione (PubChem CID 139081862) has the molecular formula C27H20ClNO3 and a molecular weight of 441.91 g/mol.
| Compound Name | 4'-(4-Chlorophenyl)-1'-methyldispiro[indan-2,2'-pyrrolidine-3',2''-indan]-1,3,1''-trione |
|---|---|
| PubChem CID | 139081862 |
| Molecular Formula | C27H20ClNO3 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccc(Cl)cc2)[C@]2(Cc3ccccc3C2=O)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H20ClNO3/c1-29-15-22(16-10-12-18(28)13-11-16)26(14-17-6-2-3-7-19(17)23(26)30)27(29)24(31)20-8-4-5-9-21(20)25(27)32/h2-13,22H,14-15H2,1H3/t22-,26+/m1/s1 |
| InChIKey | VUXOCPYHHYWKAK-GJZUVCINSA-N |
| XLogP | 4.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|