About 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate)
2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) (PubChem CID 139082244) has the molecular formula C18H24N2O6
and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate).
Molecular Properties
| Compound Name | 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) |
| PubChem CID | 139082244 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) |
| SMILES | C[NH+](C)CC[NH3+].O=C(O)c1cccc([O-])c1.O=C(O)c1cccc([O-])c1 |
| InChI | InChI=1S/2C7H6O3.C4H12N2/c2*8-6-3-1-2-5(4-6)7(9)10;1-6(2)4-3-5/h2*1-4,8H,(H,9,10);3-5H2,1-2H3 |
| InChIKey | RLOVGBKOXHINQY-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate)?
The IUPAC name of 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) (CID 139082244) is 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate).
What is the SMILES notation for 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate)?
The canonical SMILES for 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) is C[NH+](C)CC[NH3+].O=C(O)c1cccc([O-])c1.O=C(O)c1cccc([O-])c1.
What is the InChIKey of 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate)?
The InChIKey is RLOVGBKOXHINQY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6O3.C4H12N2/c2*8-6-3-1-2-5(4-6)7(9)10;1-6(2)4-3-5/h2*1-4,8H,(H,9,10);3-5H2,1-2H3.
What are the key properties of 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate)?
2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) has a molecular weight of 364.40 g/mol, XLogP of -1.71, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylethyl(dimethyl)azanium;bis(3-carboxyphenolate) is sourced from PubChem (CID 139082244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).