About 2-carboxyphenolate;pyridin-1-ium-2,3-diamine
2-carboxyphenolate;pyridin-1-ium-2,3-diamine (PubChem CID 139082277) has the molecular formula C12H13N3O3
and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-carboxyphenolate;pyridin-1-ium-2,3-diamine.
Molecular Properties
| Compound Name | 2-carboxyphenolate;pyridin-1-ium-2,3-diamine |
| PubChem CID | 139082277 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-carboxyphenolate;pyridin-1-ium-2,3-diamine |
| SMILES | Nc1ccc[nH+]c1N.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C7H6O3.C5H7N3/c8-6-4-2-1-3-5(6)7(9)10;6-4-2-1-3-8-5(4)7/h1-4,8H,(H,9,10);1-3H,6H2,(H2,7,8) |
| InChIKey | WWQVRWRWQPJIPJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-carboxyphenolate;pyridin-1-ium-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;pyridin-1-ium-2,3-diamine?
The IUPAC name of 2-carboxyphenolate;pyridin-1-ium-2,3-diamine (CID 139082277) is 2-carboxyphenolate;pyridin-1-ium-2,3-diamine.
What is the SMILES notation for 2-carboxyphenolate;pyridin-1-ium-2,3-diamine?
The canonical SMILES for 2-carboxyphenolate;pyridin-1-ium-2,3-diamine is Nc1ccc[nH+]c1N.O=C(O)c1ccccc1[O-].
What is the InChIKey of 2-carboxyphenolate;pyridin-1-ium-2,3-diamine?
The InChIKey is WWQVRWRWQPJIPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C5H7N3/c8-6-4-2-1-3-5(6)7(9)10;6-4-2-1-3-8-5(4)7/h1-4,8H,(H,9,10);1-3H,6H2,(H2,7,8).
What are the key properties of 2-carboxyphenolate;pyridin-1-ium-2,3-diamine?
2-carboxyphenolate;pyridin-1-ium-2,3-diamine has a molecular weight of 247.25 g/mol, XLogP of 0.12, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;pyridin-1-ium-2,3-diamine is sourced from PubChem (CID 139082277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).