C26H20N4O6 — CID 139082317
1-N,4-N-dipyridin-3-ylbenzene-1,4-dicarboxamide;terephthalic acid (PubChem CID 139082317) has the molecular formula C26H20N4O6 and a molecular weight of 484.47 g/mol. Its IUPAC name is 1-N,4-N-dipyridin-3-ylbenzene-1,4-dicarboxamide;terephthalic acid.
| Compound Name | 1-N,4-N-dipyridin-3-ylbenzene-1,4-dicarboxamide;terephthalic acid |
|---|---|
| PubChem CID | 139082317 |
| Molecular Formula | C26H20N4O6 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 1-N,4-N-dipyridin-3-ylbenzene-1,4-dicarboxamide;terephthalic acid |
| SMILES | O=C(Nc1cccnc1)c1ccc(C(=O)Nc2cccnc2)cc1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H14N4O2.C8H6O4/c23-17(21-15-3-1-9-19-11-15)13-5-7-14(8-6-13)18(24)22-16-4-2-10-20-12-16;9-7(10)5-1-2-6(4-3-5)8(11)12/h1-12H,(H,21,23)(H,22,24);1-4H,(H,9,10)(H,11,12) |
| InChIKey | AKHHWQKMBVESTQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |